For research use only. Not for therapeutic Use.
Hydrocinnamic acid-d9(Cat No.:I041440)is a deuterated derivative of hydrocinnamic acid, where nine hydrogen atoms are replaced with deuterium. This compound is primarily used in research and applications that require isotopic labeling for advanced analytical techniques, such as mass spectrometry or nuclear magnetic resonance (NMR) spectroscopy. It serves as a stable isotope tracer in studies of metabolic pathways, drug metabolism, and molecular interactions. Hydrocinnamic acid-d9 retains the biological properties of its non-deuterated counterpart, making it valuable for precise and accurate studies in pharmaceutical and biochemical research.
CAS Number | 93131-15-8 |
Synonyms | 2,2,3,3-tetradeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
Molecular Formula | C9HD9O2 |
Purity | ≥95% |
IUPAC Name | 2,2,3,3-tetradeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
InChI | InChI=1S/C9H10O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11)/i1D,2D,3D,4D,5D,6D2,7D2 |
InChIKey | XMIIGOLPHOKFCH-NVLGFDPUSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])([2H])C(=O)O)[2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |