For research use only. Not for therapeutic Use.
Hydrocortisone 17-propionate 21-acetate is a synthetic corticosteroid used for its anti-inflammatory and immunosuppressive properties. It effectively treats various skin conditions, such as eczema, psoriasis, and dermatitis, by reducing inflammation and itching. This compound combines hydrocortisone with propionate and acetate esters, enhancing its potency and duration of action. It is typically applied topically and is known for its efficacy in managing symptoms with minimal side effects when used as directed.
CAS Number | 74050-20-7 |
Synonyms | (11β)-21-(Acetyloxy)-11-hydroxy-17-(1-oxopropoxy)pregn-4-ene-3,20-dione; ?Cortisol 17-Propionate 21-Acetate; Hydrocortisone Aceponate; |
Molecular Formula | C26H36O7 |
Purity | ≥95% |
Target | Vitamin D Related/Nuclear Receptor |
Storage | -20°C |
IUPAC Name | [(8S,9S,10R,11S,13S,14S,17R)-17-(2-acetyloxyacetyl)-11-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
InChI | InChI=1S/C26H36O7/c1-5-22(31)33-26(21(30)14-32-15(2)27)11-9-19-18-7-6-16-12-17(28)8-10-24(16,3)23(18)20(29)13-25(19,26)4/h12,18-20,23,29H,5-11,13-14H2,1-4H3/t18-,19-,20-,23+,24-,25-,26-/m0/s1 |
InChIKey | MFBMYAOAMQLLPK-FZNHGJLXSA-N |
SMILES | CCC(=O)OC1(CCC2C1(CC(C3C2CCC4=CC(=O)CCC34C)O)C)C(=O)COC(=O)C |