For research use only. Not for therapeutic Use.
Hydrocortisone-d3 is a high-purity deuterated compound essential for advanced pharmaceutical research. This isotopically labeled version of Hydrocortisone contains three deuterium atoms, making it crucial for studies on glucocorticoid activity, steroid metabolism, and anti-inflammatory mechanisms. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of pharmacokinetic and pharmacodynamic studies. With improved stability and consistency, Hydrocortisone-d3 integrates seamlessly into various experimental protocols, offering a robust and cost-effective solution for high-precision scientific investigations. Ideal for research and development, it supports the advancement of safer and more effective therapeutic agents.
| Catalog Number | S000807 |
| CAS Number | 115699-92-8 |
| Molecular Formula | C21H27D3O5 |
| Purity | ≥95% |
| IUPAC Name | (8S,9S,10R,11S,13S,14S,17R)-9,12,12-trideuterio-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,11,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| InChI | InChI=1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1/i10D2,18D |
| InChIKey | JYGXADMDTFJGBT-GNVNMZRRSA-N |
| SMILES | [2H][C@]12[C@@H](CCC3=CC(=O)CC[C@@]31C)[C@@H]4CC[C@@]([C@]4(C([C@@H]2O)([2H])[2H])C)(C(=O)CO)O |
