Hydrocortisone-d7(Cat No.:S000840) is a deuterated version of hydrocortisone, where seven hydrogen atoms are replaced with deuterium, resulting in the molecular formula C21H23D7O5. This stable isotope-labeled compound is widely used in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy to enhance the accuracy and sensitivity of pharmacokinetic and metabolic studies. Hydrocortisone-d7 is crucial in researching cortisol metabolism and its mechanism of action, especially in understanding inflammatory responses and stress physiology. It aids in developing more effective therapeutic strategies for diseases related to cortisol imbalance, such as adrenal insufficiency and inflammatory conditions.
Catalog Number | S000840 |
Molecular Formula | C21H23D7O5 |
Purity | ≥95% |
IUPAC Name | (8S,9S,10R,11S,13S,14S,17R)-2,2,4,6,6-pentadeuterio-17-(2,2-dideuterio-2-hydroxyacetyl)-11,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
InChI | InChI=1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1/i3D2,5D2,9D,11D2 |
InChIKey | JYGXADMDTFJGBT-BCRCSIFJSA-N |
SMILES | CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4(C(=O)CO)O)C)O |