For research use only. Not for therapeutic Use.
Hydroquinidine 9-phenanthryl ether(CAT: M105849) is a synthetic compound derived from hydroquinidine, a stereoisomer of quinine and an alkaloid found in the cinchona tree. Its mode of action involves being a phenanthryl ether derivative of hydroquinidine. Pharmacologically, Hydroquinidine 9-phenanthryl ether is not used as a therapeutic drug on its own. Instead, it is likely used in pharmaceutical research as a building block or intermediate in organic synthesis. Its unique structure makes it a valuable starting material for preparing various compounds with potential biological activities or for studying the structure-activity relationships of related molecules.
Catalog Number | M105849 |
CAS Number | 135042-88-5 |
Molecular Formula | C34H34N2O2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 4-[(S)-[(2R,4S,5S)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-phenanthren-9-yloxymethyl]-6-methoxyquinoline |
InChI | InChI=1S/C34H34N2O2/c1-3-22-21-36-17-15-23(22)18-32(36)34(29-14-16-35-31-13-12-25(37-2)20-30(29)31)38-33-19-24-8-4-5-9-26(24)27-10-6-7-11-28(27)33/h4-14,16,19-20,22-23,32,34H,3,15,17-18,21H2,1-2H3/t22-,23+,32-,34+/m1/s1 |
InChIKey | TWOVHUYOMTVDRB-FVSKFNOUSA-N |
SMILES | CCC1CN2CCC1CC2C(C3=C4C=C(C=CC4=NC=C3)OC)OC5=CC6=CC=CC=C6C7=CC=CC=C75 |