For research use only. Not for therapeutic Use.
Hydroxy-PEG4-acid (Cat No.: I017217) is a non-cleavable ADClinker containing 4 units of PEG, which can be used to synthesize anti-Chemicalbook conjugated drug (ADC). Hydroxy-PEG4-acid is also a kind of PROTAClinker, which belongs to the PEG class and can be used to synthesize PROTAC molecules.
| Catalog Number | I017217 |
| CAS Number | 937188-59-5 |
| Molecular Formula | C₁₁H₂₂O₇ |
| Purity | ≥95% |
| Target | PROTAC |
| Storage | 2-8°C |
| IUPAC Name | 3-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C11H22O7/c12-2-4-16-6-8-18-10-9-17-7-5-15-3-1-11(13)14/h12H,1-10H2,(H,13,14) |
| InChIKey | UQWLGZFJGVEDCQ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCO)C(=O)O |
| Reference | [1]. Tinya Abrams, et al. Antibody drug conjugates. WO2016203432A1. |
