For research use only. Not for therapeutic Use.
Hydroxy Pioglitazone-d4 (M-IV) is a deuterated form of hydroxy pioglitazone, specifically labeled with four deuterium atoms. This compound is primarily used in pharmaceutical research to study the metabolism and pharmacokinetics of pioglitazone, an antidiabetic drug. The deuterium labeling enhances the precision of analytical techniques such as NMR and mass spectrometry, allowing for detailed investigations into the metabolic pathways, absorption, distribution, and elimination of the drug. Hydroxy Pioglitazone-d4 (M-IV) is valuable for understanding the drug’s interactions and behavior in biological systems, aiding in the optimization of therapeutic strategies for diabetes management.
CAS Number | 1188263-49-1 |
Synonyms | 5-[[4-[2-[5-(1-Hydroxyethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-2,4-thiazolidinedione-d4 |
Molecular Formula | C19H20N2O4S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-[[2,3,5,6-tetradeuterio-4-[2-[5-(1-hydroxyethyl)pyridin-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
InChI | InChI=1S/C19H20N2O4S/c1-12(22)14-4-5-15(20-11-14)8-9-25-16-6-2-13(3-7-16)10-17-18(23)21-19(24)26-17/h2-7,11-12,17,22H,8-10H2,1H3,(H,21,23,24)/i2D,3D,6D,7D |
InChIKey | OXVFDZYQLGRLCD-USSMZTJJSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1CC2C(=O)NC(=O)S2)[2H])[2H])OCCC3=NC=C(C=C3)C(C)O)[2H] |