For research use only. Not for therapeutic Use.
Hydroxy Pioglitazone (M-II) is a primary metabolite of the antidiabetic drug Pioglitazone, essential for advanced pharmaceutical research. This compound plays a crucial role in studying the pharmacokinetics, metabolism, and therapeutic effects of Pioglitazone. Its unique properties enable detailed analysis of metabolic pathways and drug interactions. Hydroxy Pioglitazone (M-II) is highly valued for its purity and stability, making it an indispensable tool in diabetes research and the development of effective treatments for type 2 diabetes.
| Catalog Number | R007017 |
| CAS Number | 101931-00-4 |
| Synonyms | 5-[[4-[2-(5-Ethyl-2-pyridinyl]-2-hydroxyethoxy]phenyl]methyl]-2,4-thiazolidinedione |
| Molecular Formula | C19H20N2O4S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-[[4-[2-(5-ethylpyridin-2-yl)-2-hydroxyethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| InChI | InChI=1S/C19H20N2O4S/c1-2-12-5-8-15(20-10-12)16(22)11-25-14-6-3-13(4-7-14)9-17-18(23)21-19(24)26-17/h3-8,10,16-17,22H,2,9,11H2,1H3,(H,21,23,24) |
| InChIKey | RMTFRGFLVHAYCI-UHFFFAOYSA-N |
| SMILES | CCC1=CN=C(C=C1)C(COC2=CC=C(C=C2)CC3C(=O)NC(=O)S3)O |
