For research use only. Not for therapeutic Use.
Hydroxyachillin（Cat No.:M120483）is a bioactive compound found in certain medicinal plants, particularly those of the Achillea genus, known for its therapeutic properties. It exhibits significant anti-inflammatory, antimicrobial, and antioxidant activities, making it valuable in traditional and modern medicine. Hydroxyachillin is used to treat wounds, skin conditions, and inflammatory disorders. Its chemical structure allows it to interact with various biological pathways, enhancing its medicinal efficacy. Research into hydroxyachillin continues to explore its potential in pharmaceuticals, emphasizing its role in natural product chemistry and integrative medicine.
| Catalog Number | M120483 |
| CAS Number | 10180-88-8 |
| Molecular Formula | C15H18O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (3S,3aR,4S,9aS,9bR)-4-hydroxy-3,6,9-trimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione |
| InChI | InChI=1S/C15H18O4/c1-6-4-10(17)13-8(3)15(18)19-14(13)12-7(2)5-9(16)11(6)12/h5,8,10,12-14,17H,4H2,1-3H3/t8-,10-,12-,13+,14+/m0/s1 |
| InChIKey | YMUOZXZDDBRJEP-XUNJKSNWSA-N |
| SMILES | CC1C2C(CC(=C3C(C2OC1=O)C(=CC3=O)C)C)O |
