For research use only. Not for therapeutic Use.
Hydroxyalbendazole (Cat No.:C000890) is a derivative of albendazole, which is an anthelmintic medication used to treat parasitic worm infections in humans and animals. Hydroxyalbendazole is formed when albendazole is metabolized in the body. It exhibits similar anthelmintic activity and plays a role in the mechanism of action of albendazole. The compound’s pharmacological properties make it effective against a wide range of parasites, including roundworms, tapeworms, and flukes. Due to its potency and broad-spectrum activity, hydroxy albendazole is a valuable component in the treatment and control of various parasitic infections in both veterinary and human medicine.
| Catalog Number | C000890 |
| CAS Number | 107966-05-2 |
| Synonyms | [5-[(3-Hydroxypropyl)thio]-1H-benzimidazol-2-yl]-carbamic acid methyl ester |
| Molecular Formula | C₁₂H₁₅N₃O₃S |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C, Inert atmosphere |
| IUPAC Name | methyl N-[6-(3-hydroxypropylsulfanyl)-1H-benzimidazol-2-yl]carbamate |
| InChI | InChI=1S/C12H15N3O3S/c1-18-12(17)15-11-13-9-4-3-8(7-10(9)14-11)19-6-2-5-16/h3-4,7,16H,2,5-6H2,1H3,(H2,13,14,15,17) |
| InChIKey | BPWSOQXIMDMJHB-UHFFFAOYSA-N |
| SMILES | COC(=O)NC1=NC2=C(N1)C=C(C=C2)SCCCO |
| Reference | Wu Zhexue., Antimicrobial Agents and Chemotherapy, 57, 5448-5456, (2013) |
