For research use only. Not for therapeutic Use.
Hydroxyanigorufone (Cat.No:R064697) is a natural compound derived from fungi. It exhibits diverse biological activities and has garnered interest in pharmaceutical research. Studies suggest potential antifungal, antibacterial, and cytotoxic properties. Further investigation is underway to explore its therapeutic applications and potential as a lead compound in drug development.
| Catalog Number | R064697 |
| CAS Number | 56252-02-9 |
| Molecular Formula | C19H12O3 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-hydroxy-9-(4-hydroxyphenyl)phenalen-1-one |
| InChI | InChI=1S/C19H12O3/c20-14-7-4-11(5-8-14)15-9-6-12-2-1-3-13-10-16(21)19(22)18(15)17(12)13/h1-10,20-21H |
| InChIKey | HTELDEYOMOTOBI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=C(C(=O)C3=C(C=C2)C4=CC=C(C=C4)O)O |
| Reference | <span style=”color:#000000;”><span style=”font-size:12px;”><span style=”font-family:arial,helvetica,sans-serif;”>1.Liu, Fang, et al. "Diarylheptanoids and phenylphenalenones from Musa itinerans fruits." <i style=”font-family: Arial, sans-serif; font-size: 13px;”>Phytochemistry</i> 103 (2014): 171-177.</span></span></span> |
