For research use only. Not for therapeutic Use.
Hydroxyectoine（Cat No.:M032836）is a naturally occurring osmolyte produced by extremophilic microorganisms to protect themselves against environmental stress, such as high salinity, extreme temperatures, and UV radiation. This compound stabilizes proteins and cellular structures, making it valuable in cosmetic, pharmaceutical, and biotechnological applications. Its high purity and efficacy enhance skin hydration, protect against UV-induced damage, and improve the stability of therapeutic proteins and enzymes. Hydroxyectoine is essential for developing advanced skincare products and bioprotectants, contributing to innovations in protecting human health and improving the shelf life of biopharmaceuticals.
| Catalog Number | M032836 |
| CAS Number | 165542-15-4 |
| Molecular Formula | C6H10N2O3 |
| Purity | ≥95% |
| Storage | -80°C |
| IUPAC Name | (5S,6S)-5-hydroxy-2-methyl-1,4,5,6-tetrahydropyrimidine-6-carboxylic acid |
| InChI | InChI=1S/C6H10N2O3/c1-3-7-2-4(9)5(8-3)6(10)11/h4-5,9H,2H2,1H3,(H,7,8)(H,10,11)/t4-,5-/m0/s1 |
| InChIKey | KIIBBJKLKFTNQO-WHFBIAKZSA-N |
| SMILES | CC1=NCC(C(N1)C(=O)O)O |
