For research use only. Not for therapeutic Use.
Hydroxyhexamide(CAT: I000038) is a derivative of the sulfonylurea class of compounds, structurally related to hexamide, known for its role in modulating insulin secretion. Sulfonylureas function by stimulating insulin release from pancreatic β-cells through the inhibition of ATP-sensitive potassium (K⁺) channels, leading to cell depolarization and subsequent insulin secretion. Hydroxyhexamide is primarily utilized in metabolic disease research, particularly in studying the mechanisms of type 2 diabetes mellitus (T2DM) and pancreatic β-cell function. Its structure allows researchers to explore potential therapeutic targets for enhancing insulin sensitivity and developing advanced treatments for diabetes and metabolic disorders.
CAS Number | 3168-01-2 |
Molecular Formula | C15H22N2O4S |
Purity | ≥95% |
Target | Drug Metabolite |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IUPAC Name | 1-cyclohexyl-3-[4-(1-hydroxyethyl)phenyl]sulfonylurea |
InChI | InChI=1S/C15H22N2O4S/c1-11(18)12-7-9-14(10-8-12)22(20,21)17-15(19)16-13-5-3-2-4-6-13/h7-11,13,18H,2-6H2,1H3,(H2,16,17,19) |
InChIKey | VQDAEOYLIBGCHE-UHFFFAOYSA-N |
SMILES | CC(C1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2CCCCC2)O |