For research use only. Not for therapeutic Use.
Hydroxysafflor Yellow A (CAT: I004877) is a water-soluble chalcone glycoside extracted from the flowers of Carthamus tinctorius (safflower). Known for its potent antioxidant, anti-inflammatory, and neuroprotective properties, HSYA plays a significant role in cardiovascular and neurological research. It modulates oxidative stress, reduces inflammation, and improves microcirculation, making it valuable for studying conditions such as ischemic stroke, myocardial infarction, and atherosclerosis. Hydroxysafflor Yellow A is also investigated for its therapeutic potential in neurodegenerative diseases and tissue repair. Its multifaceted pharmacological activities make it an essential compound for advancing research into natural product-based therapeutics.
CAS Number | 78281-02-4 |
Molecular Formula | C27H32O16 |
Purity | ≥95% |
Target | Autophagy |
Solubility | DMSO: 39 mg/mL |
Storage | 3 years -20C powder |
IUPAC Name | (6E)-2,5-dihydroxy-6-[(E)-1-hydroxy-3-(4-hydroxyphenyl)prop-2-enylidene]-2,4-bis[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohex-4-ene-1,3-dione |
InChI | InChI=1S/C27H32O16/c28-7-12-16(32)19(35)21(37)23(42-12)15-18(34)14(11(31)6-3-9-1-4-10(30)5-2-9)24(39)27(41,25(15)40)26-22(38)20(36)17(33)13(8-29)43-26/h1-6,12-13,16-17,19-23,26,28-38,41H,7-8H2/b6-3+,14-11+/t12-,13-,16-,17-,19+,20+,21-,22-,23+,26-,27?/m1/s1 |
InChIKey | IAVUBSCVWHLRGE-UXEKTNMQSA-N |
SMILES | C1=CC(=CC=C1/C=C/C(=C\2/C(=C(C(=O)C(C2=O)([C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)/O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |