For research use only. Not for therapeutic Use.
Hydroxyzine-d4 2HCl is a deuterated version of the antihistamine Hydroxyzine, featuring four deuterium atoms. This isotopically labeled compound is crucial for advanced pharmacokinetic studies, metabolic pathway investigations, and drug development research. Hydroxyzine-d4 2HCl maintains the pharmacological properties of its non-labeled counterpart, making it an ideal internal standard for analytical methods such as mass spectrometry. With its enhanced stability and precision, this compound ensures reliable and reproducible results in various experimental setups. It is particularly valuable in research involving the metabolism and pharmacodynamics of antihistamines, providing deeper insights into their therapeutic actions and side effects.
Catalog Number | M072645 |
CAS Number | 1219805-91-0 |
Molecular Formula | C21H29Cl3N2O2 |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | -20°C |
IUPAC Name | 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]-1,1,2,2-tetradeuterioethanol;dihydrochloride |
InChI | InChI=1S/C21H27ClN2O2.2ClH/c22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25;;/h1-9,21,25H,10-17H2;2*1H/i15D2,17D2;; |
InChIKey | ANOMHKZSQFYSBR-PCOYNHINSA-N |
SMILES | 2H]C([2H])(C([2H])([2H])OCCN1CCN(CC1)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl)O.Cl.Cl |