For research use only. Not for therapeutic Use.
Hydroxyzine Dihydrochloride is a first-generation antihistamine with anxiolytic, sedative, and antiemetic properties. This compound is primarily used to manage anxiety, nausea, and allergies, and it is often prescribed as a premedication for surgical procedures due to its calming effects. Hydroxyzine acts by blocking histamine receptors and modulating serotonin levels, contributing to its therapeutic efficacy. Research continues to explore its broader applications in mental health and its potential interactions with other medications, enhancing the understanding of its pharmacological profile.
| Catalog Number | A000420 |
| CAS Number | 2192-20-3 |
| Synonyms | 2192-20-3; 2-(2-(4-((4-Chlorophenyl)(phenyl)methyl)piperazin-1-yl)ethoxy)ethanol dihydrochloride; Hydroxyzine hydrochloride; Arcanax; Neurolax |
| Molecular Formula | C21H29Cl3N2O2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | >17.2mg/mL in DMSO |
| Storage | -20°C |
| InChI | 1S/C21H27ClN2O2.2ClH/c22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25;;/h1-9,21,25H,10-17H2;2*1H |
| InChIKey | ANOMHKZSQFYSBR-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCOCCO)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl.Cl.Cl |
