For research use only. Not for therapeutic Use.
Hypericin（Cat No.:I004020） is a naturally occurring compound derived from Hypericum perforatum, commonly known as St. John’s wort. It possesses photosensitive properties and exhibits a range of biological activities. Hypericin is known for its antiviral properties, particularly against enveloped viruses. It also demonstrates anticancer activity by inhibiting certain tyrosine kinases, with an IC50 value of 7.5 μM. Additionally, hypericin has been investigated for its potential antidepressant effects. Its diverse pharmacological properties make it an intriguing compound for further research and potential therapeutic applications.
| Catalog Number | I004020 |
| CAS Number | 548-04-9 |
| Synonyms | NSC 407313 |
| Molecular Formula | C₃₀H₁₆O₈ |
| Purity | ≥95% |
| Target | Anti-infection |
| Solubility | DMSO: ≤ 6.2 mg/mL |
| Storage | -20°C |
| IUPAC Name | 9,11,13,16,18,20-hexahydroxy-5,24-dimethyloctacyclo[13.11.1.12,10.03,8.04,25.019,27.021,26.014,28]octacosa-1(26),2,4(25),5,8,10,12,14(28),15(27),16,18,20,23-tridecaene-7,22-dione |
| InChI | InChI=1S/C30H16O8/c1-7-3-9(31)19-23-15(7)16-8(2)4-10(32)20-24(16)28-26-18(12(34)6-14(36)22(26)30(20)38)17-11(33)5-13(35)21(29(19)37)25(17)27(23)28/h3-6,33-38H,1-2H3 |
| InChIKey | YDOIFHVUBCIUHF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(C3=C(C=C(C4=C3C5=C2C1=C6C(=CC(=O)C7=C(C8=C(C=C(C4=C8C5=C67)O)O)O)C)O)O)O |
