Hypocrellin A(Cat No.:R065835) is a naturally occurring photosensitizer with notable photodynamic therapy (PDT) potential. It functions by generating reactive oxygen species upon exposure to light, which selectively damages target cells. Its mode of action involves light-induced oxidative stress and cell death. Pharmacologically, it finds application in cancer therapy and dermatology, offering a non-invasive approach for treating tumors and certain skin conditions. This compound’s PDT properties make it a promising candidate for medical interventions, allowing for targeted and minimally invasive treatments with potential advancements in cancer and dermatological care.
| Catalog Number | R065835 |
| CAS Number | 77029-83-5 |
| Molecular Formula | C30H26O10 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 12-acetyl-9,13,17-trihydroxy-5,10,16,21-tetramethoxy-13-methylhexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4(22),5,9,16,18(23),20-nonaene-7,19-dione |
| InChI | InChI=1S/C30H26O10/c1-10(31)25-24-22-16-11(9-30(25,2)36)28(39-5)26(34)17-12(32)7-14(37-3)19(21(16)17)20-15(38-4)8-13(33)18(23(20)22)27(35)29(24)40-6/h7-8,25,34-36H,9H2,1-6H3 |
| InChIKey | VANSZAOQCMTTPB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1C2=C3C4=C(CC1(C)O)C(=C(C5=C4C(=C6C3=C(C(=O)C=C6OC)C(=C2OC)O)C(=CC5=O)OC)O)OC |
