Hypoxanthine-13C2,15N is an isotopically labeled version of hypoxanthine, a naturally occurring purine derivative, with two carbon atoms labeled with carbon-13 and one nitrogen atom labeled with nitrogen-15. This compound is vital for studying purine metabolism, nucleotide biosynthesis, and the enzymatic activity of xanthine oxidase. The incorporation of stable isotopes enhances the precision of analytical techniques such as mass spectrometry and NMR spectroscopy, allowing for detailed tracking of metabolic processes and interactions in biological systems. Hypoxanthine-13C2,15N is particularly valuable in research focused on gout, cancer, and other conditions where purine metabolism plays a critical role, providing reliable data for drug development and biochemical studies.
| Catalog Number | R013921 |
| CAS Number | 1246820-04-1 |
| Synonyms | 1,9-Dihydro-6H-purin-6-one-13C2,15N; 3H-Purin-6-ol-13C2,15N; 6-Hydroxy-1H-purine-13C2,15N; 6-Hydroxypurine-13C2,15N; 6-Oxopurine-13C2,15N; Hypoxanthine Enol-13C2,15N; NSC 129419-13C2,15N; NSC 14665-13C2,15N; Purin-6-ol-13C2,15N; Sarcine-13C2,15N; Sar |
| Molecular Formula | C5H4N4O |
| Purity | ≥95% |
| Storage | -80°C |
| IUPAC Name | 1,7-dihydropurin-6-one |
| InChI | InChI=1S/C5H4N4O/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10)/i1+1,4+1,6+1 |
| InChIKey | FDGQSTZJBFJUBT-JDKPDMQJSA-N |
| SMILES | C1=N[13C]2=C(C(=O)N1)[15NH][13CH]=N2 |
