HZ-1157 (Cat.No:I007235) is a small molecule inhibitor that targets the enzyme dihydroorotate dehydrogenase (DHODH), a key enzyme in the de novo pyrimidine synthesis pathway. By inhibiting DHODH, HZ-1157 disrupts DNA and RNA synthesis, leading to the inhibition of cell proliferation. It is being investigated for its potential in the treatment of various cancers and autoimmune diseases.
| Catalog Number | I007235 |
| CAS Number | 1009734-33-1 |
| Synonyms | HZ-1157; HZ 1157; HZ1157. Dengue Virus Inhibitor II.;5-(1,1-Dimethylethoxy)- 2,4-quinazolinediamine |
| Molecular Formula | C12H16N4O |
| Purity | ≥95% |
| Target | HCV Protease |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 5-[(2-methylpropan-2-yl)oxy]quinazoline-2,4-diamine |
| InChI | InChI=1S/C12H16N4O/c1-12(2,3)17-8-6-4-5-7-9(8)10(13)16-11(14)15-7/h4-6H,1-3H3,(H4,13,14,15,16) |
| InChIKey | JQHKDYFLRJIBLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=CC=CC2=C1C(=NC(=N2)N)N |
| Reference | </br>1:Yu Y, Jing JF, Tong XK, He PL, Li YC, Hu YH, Tang W, Zuo JP. Discovering novel anti-HCV compounds with inhibitory activities toward HCV NS3/4A protease. Acta Pharmacol Sin. 2014 Aug;35(8):1074-81. doi: 10.1038/aps.2014.55. PubMed PMID: 25066323; PubMed Central PMCID: PMC4125721. |
