For research use only. Not for therapeutic Use.
I2906(Cat No.:I003198)is a compound that has demonstrated both antimycobacterial and cytotoxic activity against Mycobacterium tuberculosis, the bacterium responsible for tuberculosis (TB). It exhibits promising effectiveness in inhibiting the growth and survival of TB-causing bacteria. Additionally, I2906 displays cytotoxicity, indicating its potential to selectively target and kill infected cells. These findings suggest that I2906 holds promise as a potential candidate for the development of new drugs or treatment strategies against tuberculosis.
CAS Number | 331963-29-2 |
Synonyms | 1-ethyl-4-hydroxy-2-oxo-N/’-tridecanoylquinoline-3-carbohydrazide |
Molecular Formula | C25H37N3O4 |
Purity | ≥95% |
Target | Bacterial |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | 1-ethyl-4-hydroxy-2-oxo-N'-tridecanoylquinoline-3-carbohydrazide |
InChI | InChI=1S/C25H37N3O4/c1-3-5-6-7-8-9-10-11-12-13-18-21(29)26-27-24(31)22-23(30)19-16-14-15-17-20(19)28(4-2)25(22)32/h14-17,30H,3-13,18H2,1-2H3,(H,26,29)(H,27,31) |
InChIKey | WIEYSVJHCLJOJT-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCC(=O)NNC(=O)C1=C(C2=CC=CC=C2N(C1=O)CC)O |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |