For research use only. Not for therapeutic Use.
IAA-Leu(CAT: R074569) is a compound of interest in the realm of biochemistry and molecular biology. It refers to Indole-3-acetic acid (IAA) conjugated with the amino acid Leucine (Leu). IAA is a naturally occurring plant hormone, also known as auxin, that plays a crucial role in various aspects of plant growth and development. The conjugation of IAA with Leucine may impact the bioactivity and transport of IAA within plants, potentially affecting auxin-related processes.
Catalog Number | R074569 |
CAS Number | 36838-63-8 |
Molecular Formula | C16H20N2O3 |
Purity | ≥95% |
IUPAC Name | (2S)-2-[[2-(1H-indol-3-yl)acetyl]amino]-4-methylpentanoic acid |
InChI | InChI=1S/C16H20N2O3/c1-10(2)7-14(16(20)21)18-15(19)8-11-9-17-13-6-4-3-5-12(11)13/h3-6,9-10,14,17H,7-8H2,1-2H3,(H,18,19)(H,20,21)/t14-/m0/s1 |
InChIKey | HCZNPUHZYPPINM-AWEZNQCLSA-N |
SMILES | CC(C)CC(C(=O)O)NC(=O)CC1=CNC2=CC=CC=C21 |