For research use only. Not for therapeutic Use.
Ibacitabine(CAT: R072766) is an antiviral and antineoplastic nucleoside analog. Its mode of action involves incorporation into viral or cancerous DNA during replication, which leads to chain termination and inhibition of further growth. Ibacitabine is used in medical research and clinical settings for the treatment of certain viral infections and as a potential chemotherapeutic agent against various cancers.
| Catalog Number | R072766 |
| CAS Number | 611-53-0 |
| Molecular Formula | C9H12IN3O4 |
| Purity | ≥95% |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidin-2-one |
| InChI | InChI=1S/C9H12IN3O4/c10-4-2-13(9(16)12-8(4)11)7-1-5(15)6(3-14)17-7/h2,5-7,14-15H,1,3H2,(H2,11,12,16)/t5-,6+,7+/m0/s1 |
| InChIKey | WEVJJMPVVFNAHZ-RRKCRQDMSA-N |
| SMILES | C1C(C(OC1N2C=C(C(=NC2=O)N)I)CO)O |
