For research use only. Not for therapeutic Use.
Ibacitabine(Cat No.:R072766)is a nucleoside analog that has been investigated primarily for its antiviral and anticancer properties. It works by inhibiting viral replication or disrupting cellular DNA synthesis in cancer cells. Ibacitabine is specifically designed to interfere with the activity of enzymes like reverse transcriptase in viruses and DNA polymerases in cancer cells, preventing their proliferation. While its primary application has been in the treatment of viral infections such as HIV, research is ongoing into its potential use in oncology, as it may help inhibit tumor growth through similar mechanisms.
CAS Number | 611-53-0 |
Molecular Formula | C9H12IN3O4 |
Purity | ≥95% |
IUPAC Name | 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidin-2-one |
InChI | InChI=1S/C9H12IN3O4/c10-4-2-13(9(16)12-8(4)11)7-1-5(15)6(3-14)17-7/h2,5-7,14-15H,1,3H2,(H2,11,12,16)/t5-,6+,7+/m0/s1 |
InChIKey | WEVJJMPVVFNAHZ-RRKCRQDMSA-N |
SMILES | C1[C@@H]([C@H](O[C@H]1N2C=C(C(=NC2=O)N)I)CO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |