For research use only. Not for therapeutic Use.
Ibudilast（Cat No.:I003810）is a potent phosphodiesterase inhibitor and anti-inflammatory agent essential for advanced neurological and immunological research. Known for its neuroprotective and immunomodulatory properties, it is crucial in studying treatments for multiple sclerosis, neuropathic pain, and drug addiction. This high-purity compound ensures precise and reliable analytical results, making it ideal for experimental setups focused on drug development and disease mechanism studies. Ibudilast supports robust investigations into novel therapeutic approaches, offering significant potential in neurology and immunology, and enhancing the understanding of its effects on the central nervous system and immune response.
| Catalog Number | I003810 |
| CAS Number | 50847-11-5 |
| Synonyms | 2-methyl-1-[2-(1-methylethyl)pyrazolo[1,5-a]pyridin-3-yl]-1-propanone |
| Molecular Formula | C₁₄H₁₈N₂O |
| Purity | ≥95% |
| Target | PDE |
| Solubility | DMSO:28 mg/ml；100 mM in ethanol |
| Storage | Store at -20°C |
| IUPAC Name | 2-methyl-1-(2-propan-2-ylpyrazolo[1,5-a]pyridin-3-yl)propan-1-one |
| InChI | InChI=1S/C14H18N2O/c1-9(2)13-12(14(17)10(3)4)11-7-5-6-8-16(11)15-13/h5-10H,1-4H3 |
| InChIKey | ZJVFLBOZORBYFE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN2C=CC=CC2=C1C(=O)C(C)C |
