Ibuprofen-13C6（Cat No.:R009193） is a high-purity isotopically labeled compound containing six 13C atoms, designed for advanced pharmaceutical and biochemical research. This 13C-labeled version of Ibuprofen is crucial for studying drug metabolism, pharmacokinetics, and anti-inflammatory mechanisms, particularly in mass spectrometry and NMR spectroscopy. The carbon-13 labeling ensures minimal isotopic interference and high precision in analytical applications, allowing for accurate tracing and quantification in metabolic pathways. Ideal for drug development and biochemical investigations, Ibuprofen-13C6 integrates seamlessly into existing protocols, providing reliable and reproducible results for high-precision scientific research.
| Catalog Number | R009193 |
| CAS Number | 1216459-54-9 |
| Synonyms | 2-(4-Isobutylphenyl)propionic Acid-13C6; |
| Molecular Formula | C13H18O2 |
| Purity | 95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-[4-(2-methylpropyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]propanoic acid |
| InChI | InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/i4+1,5+1,6+1,7+1,11+1,12+1 |
| InChIKey | HEFNNWSXXWATRW-HNHUTNRMSA-N |
| SMILES | CC(C)C[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)C(C)C(=O)O |
