Ibuprofen Carboxylic Acid (Mixture of Diastereomers) is a key intermediate in the synthesis and metabolism of the widely used nonsteroidal anti-inflammatory drug (NSAID) Ibuprofen. This compound is crucial for advanced pharmaceutical research, enabling the study of Ibuprofen’s pharmacokinetics, metabolism, and therapeutic effects. Its unique structure allows for detailed analysis of metabolic pathways and drug interactions. Ibuprofen Carboxylic Acid is highly valued for its purity and stability, making it an indispensable tool in the development of effective pain relief and anti-inflammatory treatments.
| Catalog Number | R006344 |
| CAS Number | 15935-54-3 |
| Synonyms | 4-(1-Carboxyethyl)-α-methyl-benzenepropanoic Acid; 2,4’-(2-Carboxypropyl)phenylpropionic Acid; 2-[4-(2-Carboxypropyl)phenyl]propionic Acid; Carboxyibuprofen |
| Molecular Formula | C13H16O4 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 3-[4-(1-carboxyethyl)phenyl]-2-methylpropanoic acid |
| InChI | InChI=1S/C13H16O4/c1-8(12(14)15)7-10-3-5-11(6-4-10)9(2)13(16)17/h3-6,8-9H,7H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | DIVLBIVDYADZPL-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)C(C)C(=O)O)C(=O)O |
