For research use only. Not for therapeutic Use.
Ibuprofen-d3 sodium(Cat No.:S000480) is a deuterated form of ibuprofen sodium, where three hydrogen atoms are replaced with deuterium. Ibuprofen sodium is a faster-dissolving formulation of ibuprofen, a popular nonsteroidal anti-inflammatory drug (NSAID) used to relieve pain, reduce fever, and decrease inflammation. The addition of deuterium atoms in Ibuprofen-d3 sodium enhances the molecule’s metabolic stability, providing an advantage for conducting detailed pharmacokinetic studies.
CAS Number | 1219805-09-0 |
Molecular Formula | C13H14D3NaO2 |
Purity | ≥95% |
Target | Immunology/Inflammation |
IUPAC Name | sodium;3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propanoate |
InChI | InChI=1S/C13H18O2.Na/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15;/h4-7,9-10H,8H2,1-3H3,(H,14,15);/q;+1/p-1/i3D3; |
InChIKey | PTTPUWGBPLLBKW-FJCVKDQNSA-M |
SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)[O-].[Na+] |