For research use only. Not for therapeutic Use.
Icaritin (Cat.No:I000659) is a prenylflavonoid compound derived from the herb Epimedium brevicornum. It has attracted attention for its potential anticancer properties, particularly in inhibiting the proliferation and inducing apoptosis in various cancer cell lines. Icaritin is being investigated for its therapeutic potential in cancer treatment and has shown promising results in preclinical studies.
CAS Number | 118525-40-9 |
Synonyms | 3,5,7-trihydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one |
Molecular Formula | C21H20O6 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≤ 14 mg/mL |
Storage | Store at -20°C |
IUPAC Name | 3,5,7-trihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one |
InChI | InChI=1S/C21H20O6/c1-11(2)4-9-14-15(22)10-16(23)17-18(24)19(25)20(27-21(14)17)12-5-7-13(26-3)8-6-12/h4-8,10,22-23,25H,9H2,1-3H3 |
InChIKey | TUUXBSASAQJECY-UHFFFAOYSA-N |
SMILES | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)C(=C(O2)C3=CC=C(C=C3)OC)O)C |