For research use only. Not for therapeutic Use.
Icaritin (CAT: R072418), a prenylflavonoid derived from Epimedium, exhibits promising potential in diverse health realms. It garners attention for its anti-cancer properties, potentially targeting multiple signaling pathways to inhibit proliferation and induce apoptosis in cancer cells. Furthermore, icaritin’s osteoprotective effects highlight its role in bone health, stimulating bone formation while suppressing resorption. These actions render icaritin a prospective candidate for cancer therapy and treatments addressing conditions like osteoporosis.
CAS Number | 118525-40-9 |
Molecular Formula | C21H20O6 |
Purity | ≥95% |
Target | Apoptosis |
IUPAC Name | 3,5-dihydroxy-2-(4-methoxyphenyl)-8,8-dimethyl-9,10-dihydropyrano[2,3-h]chromen-4-one |
InChI | InChI=1S/C21H20O6/c1-21(2)9-8-13-15(27-21)10-14(22)16-17(23)18(24)19(26-20(13)16)11-4-6-12(25-3)7-5-11/h4-7,10,22,24H,8-9H2,1-3H3 |
InChIKey | PPCHTBBOSVKORE-UHFFFAOYSA-N |
SMILES | CC1(CCC2=C3C(=C(C=C2O1)O)C(=O)C(=C(O3)C4=CC=C(C=C4)OC)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |