For research use only. Not for therapeutic Use.
ICG-001(CAT: I005073) is a small molecule that functions as an antagonist of the Wnt/β-catenin/TCF signaling pathway. It specifically binds to the CREB-binding protein (CBP) and inhibits its interaction with β-catenin, thereby disrupting the formation of transcriptional activation complexes. ICG-001 has an IC50 of 3 μM for CBP binding but does not affect the related transcriptional coactivator p300. By antagonizing the Wnt/β-catenin/TCF pathway, ICG-001 can modulate gene expression regulated by this pathway and has potential therapeutic implications in diseases where aberrant Wnt signaling is involved, such as cancer and other disorders.
| Catalog Number | I005073 |
| CAS Number | 847591-62-2 |
| Synonyms | (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide |
| Molecular Formula | C₃₃H₃₂N₄O₄ |
| Purity | ≥95% |
| Target | Wnt/β-catenin |
| Solubility | DMSO ≥106mg/mL Water <1.2mg/mL Ethanol ≥42mg/mL |
| Storage | Store at -20°C |
| IC50 | 3 uM |
| IUPAC Name | (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide |
| InChI | InChI=1S/C33H32N4O4/c38-27-15-13-23(14-16-27)19-29-32(40)35(21-26-11-6-10-25-9-4-5-12-28(25)26)22-30-36(18-17-31(39)37(29)30)33(41)34-20-24-7-2-1-3-8-24/h1-16,29-30,38H,17-22H2,(H,34,41)/t29-,30+/m0/s1 |
| InChIKey | HQWTUOLCGKIECB-XZWHSSHBSA-N |
| SMILES | C1CN(C2CN(C(=O)C(N2C1=O)CC3=CC=C(C=C3)O)CC4=CC=CC5=CC=CC=C54)C(=O)NCC6=CC=CC=C6 |
