For research use only. Not for therapeutic Use.
ICI 63197(Cat No.:I010468) is a significant organic synthesis and pharmaceutical intermediate with versatile applications. It serves as a building block for the synthesis of various derivative products. Additionally, it is utilized as an active emetic ingredient in medical and veterinary applications. Triazole pyrimidinone also finds use in medicine for preventing bronchospasm and as a component in weight loss drugs. Its multifaceted nature makes it a valuable compound in the pharmaceutical industry, facilitating the development of diverse therapeutic agents and drug formulations.
CAS Number | 27277-00-5 |
Synonyms | 2-Amino-6-methyl-4-propyl-[1,2,4]triazolo[1,5-a]pyrimidin-5(4H)-one |
Molecular Formula | C9H13N5O |
Purity | ≥95% |
Target | Phosphodiesterase (PDE) |
Solubility | Soluble to 100 mM in ethanol and to 100 mM in DMSO |
Storage | 2-8°C |
IUPAC Name | 2-amino-6-methyl-4-propyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
InChI | InChI=1S/C9H13N5O/c1-3-4-13-7(15)6(2)5-14-9(13)11-8(10)12-14/h5H,3-4H2,1-2H3,(H2,10,12) |
InChIKey | UQDVRVNMIJAGRK-UHFFFAOYSA-N |
SMILES | CCCN1C(=O)C(=CN2C1=NC(=N2)N)C |