For research use only. Not for therapeutic Use.
iCRT3 (CAT: I011930) is a small molecule inhibitor that targets the Wnt/β-catenin signaling pathway, which plays a critical role in embryonic development, tissue homeostasis, and tumorigenesis. iCRT3 specifically disrupts the interaction between β-catenin and its co-transcriptional activator, TCF/LEF, leading to the inhibition of Wnt-dependent gene expression. By inhibiting the Wnt/β-catenin pathway, iCRT3 has been shown to suppress the proliferation of cancer cells and inhibit tumor growth in preclinical studies. Additionally, iCRT3 has demonstrated the ability to sensitize cancer cells to chemotherapy and enhance their apoptotic response. Therefore, iCRT3 holds potential as a therapeutic agent for the treatment of Wnt-driven cancers and as a tool for studying Wnt signaling in various biological processes.
CAS Number | 901751-47-1 |
Synonyms | iCRT3;2-[[[2-(4-ethylphenyl)-5-methyl-4-oxazolyl]methyl]thio]-N-(2-phenylethyl)acetamide |
Molecular Formula | C23H26N2O2S |
Purity | ≥95% |
Target | Apoptosis |
Solubility | Soluble in DMSO |
Storage | Store at 0-8 °C |
InChI | InChI=1S/C23H26N2O2S/c1-3-18-9-11-20(12-10-18)23-25-21(17(2)27-23)15-28-16-22(26)24-14-13-19-7-5-4-6-8-19/h4-12H,3,13-16H2,1-2H3,(H,24,26) |
InChIKey | QTDYVSIBWGVBKU-UHFFFAOYSA-N |
SMILES | O=C(NCCC1=CC=CC=C1)CSCC2=C(C)OC(C3=CC=C(CC)C=C3)=N2 |