For research use only. Not for therapeutic Use.
Idarubicin HCl（Cat No.:A001113）is a potent anthracycline used in cancer chemotherapy, particularly in the treatment of acute myeloid leukemia (AML). As a hydrochloride salt, it enhances the drug’s solubility and bioavailability. Idarubicin works by inhibiting DNA replication and repair through intercalation between DNA strands, leading to cell death. It has a strong cytotoxic effect on rapidly dividing cancer cells. Idarubicin HCl is valuable in research for its applications in studying cancer biology and developing new treatments targeting hematologic malignancies, contributing to advancements in chemotherapy.
| Catalog Number | A001113 |
| CAS Number | 57852-57-0 |
| Synonyms | 4-demethoxydaunorubicin (NSC256439, 4-DMDR) HCl |
| Molecular Formula | C26H27NO9 • HCl |
| Purity | ≥95% |
| Target | Topoisomerase |
| Solubility | >26.7mg/mL in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | (7S,9S)-9-acetyl-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride |
| InChI | InChI=1S/C26H27NO9.ClH/c1-10-21(29)15(27)7-17(35-10)36-16-9-26(34,11(2)28)8-14-18(16)25(33)20-19(24(14)32)22(30)12-5-3-4-6-13(12)23(20)31;/h3-6,10,15-17,21,29,32-34H,7-9,27H2,1-2H3;1H/t10-,15-,16-,17-,21+,26-;/m0./s1 |
| InChIKey | JVHPTYWUBOQMBP-RVFAQHLVSA-N |
| SMILES | C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C2C(=C4C(=C3O)C(=O)C5=CC=CC=C5C4=O)O)(C(=O)C)O)N)O.Cl |
