For research use only. Not for therapeutic Use.
Idebenone(Cat No.:A000213)is a synthetic analog of coenzyme Q10 (ubiquinone) known for its potent antioxidant properties and ability to support mitochondrial function. It works by protecting cells from oxidative stress and enhancing energy production, particularly in tissues with high energy demands, such as the brain, heart, and muscles. Idebenone is used to treat disorders involving mitochondrial dysfunction, including Leber’s hereditary optic neuropathy (LHON) and certain neurodegenerative diseases. Its neuroprotective effects have also attracted interest for potential applications in aging, memory improvement, and cognitive health, supporting cellular resilience against oxidative damage.
Catalog Number | A000213 |
CAS Number | 58186-27-9 |
Synonyms | CV-2619 |
Molecular Formula | C19H30O5 |
Purity | ≥95% |
Target | Apoptosis |
Storage | 3 years -20C powder |
IUPAC Name | 2-(10-hydroxydecyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
InChI | InChI=1S/C19H30O5/c1-14-15(12-10-8-6-4-5-7-9-11-13-20)17(22)19(24-3)18(23-2)16(14)21/h20H,4-13H2,1-3H3 |
InChIKey | JGPMMRGNQUBGND-UHFFFAOYSA-N |
SMILES | CC1=C(C(=O)C(=C(C1=O)OC)OC)CCCCCCCCCCO |