For research use only. Not for therapeutic Use.
IDO1-IN-18（Cat No.:I043714）is a selective inhibitor of indoleamine 2,3-dioxygenase 1 (IDO1), an enzyme involved in tryptophan metabolism and immune suppression. By inhibiting IDO1, IDO1-IN-18 disrupts the immunosuppressive environment that tumors create to evade immune surveillance. This makes it a promising candidate for cancer immunotherapy, as it can enhance anti-tumor immune responses. Additionally, IDO1-IN-18 has potential applications in treating autoimmune diseases and chronic infections by modulating immune system activity. Its high specificity and potency make it an essential tool for research on immune regulation and therapeutic development.
| CAS Number | 2328099-08-5 |
| Synonyms | N-(4-fluorophenyl)-3-[4-[4-(hydroxymethyl)-6-(trifluoromethyl)pyridin-3-yl]phenyl]oxetane-3-carboxamide |
| Molecular Formula | C23H18F4N2O3 |
| Purity | ≥95% |
| IUPAC Name | N-(4-fluorophenyl)-3-[4-[4-(hydroxymethyl)-6-(trifluoromethyl)pyridin-3-yl]phenyl]oxetane-3-carboxamide |
| InChI | InChI=1S/C23H18F4N2O3/c24-17-5-7-18(8-6-17)29-21(31)22(12-32-13-22)16-3-1-14(2-4-16)19-10-28-20(23(25,26)27)9-15(19)11-30/h1-10,30H,11-13H2,(H,29,31) |
| InChIKey | KTZHBUHZJXHRMG-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CC=C(C=C2)C3=CN=C(C=C3CO)C(F)(F)F)C(=O)NC4=CC=C(C=C4)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
