For research use only. Not for therapeutic Use.
Idronoxil(CAT: I007265), also known as Phenoxodiol, is a synthetic flavonoid derivative that exhibits anticancer properties through multiple mechanisms. It activates the mitochondrial caspase system, leading to tumor cell apoptosis. Idronoxil also inhibits the X-linked inhibitor of apoptosis (XIAP), a protein that blocks apoptosis, and disrupts the expression of FLICE inhibitory protein (FLIP), which is involved in regulating apoptosis signaling pathways. Additionally, Idronoxil inhibits DNA topoisomerase II by stabilizing the cleavable complex, preventing DNA replication, and ultimately causing tumor cell death. These actions make Idronoxil a potential therapeutic agent for various types of cancer.
| Catalog Number | I007265 |
| CAS Number | 81267-65-4 |
| Synonyms | NV-06; NV06; NV 06; Dehydroequol. Idronoxil; Phenoxodiol; Haginin E.;3-(4-Hydroxyphenyl)-2H-1-benzopyran-7-ol |
| Molecular Formula | C15H12O3 |
| Purity | ≥95% |
| Target | XIAP inhibitor |
| Solubility | soluble in DMSO, not soluble in water. |
| Storage | 0 - 4°C for short term , or -20°C for long term. |
| IUPAC Name | 3-(4-hydroxyphenyl)-2H-chromen-7-ol |
| InChI | InChI=1S/C15H12O3/c16-13-4-1-10(2-5-13)12-7-11-3-6-14(17)8-15(11)18-9-12/h1-8,16-17H,9H2 |
| InChIKey | ZZUBHVMHNVYXRR-UHFFFAOYSA-N |
| SMILES | C1C(=CC2=C(O1)C=C(C=C2)O)C3=CC=C(C=C3)O |
| Reference | </br>1: Mahoney S, Arfuso F, Millward M, Dharmarajan A. The effects of phenoxodiol on the cell cycle of prostate cancer cell lines. Cancer Cell Int. 2014 Nov 8;14(1):110. doi: 10.1186/s12935-014-0110-z. eCollection 2014. PubMed PMID: 25400509; PubMed Central PMCID: PMC4231195. |
