For research use only. Not for therapeutic Use.
IEM 1754 dihydrobromide (Cat.No:I010908) is a selective adenosine A3 receptor agonist. It has been studied for its potential therapeutic applications, including anti-inflammatory and neuroprotective effects. IEM 1754 dihydrobromide activates the adenosine A3 receptor, which can modulate immune responses and protect against neuronal damage. It is being investigated for its role in various diseases and conditions.
| Catalog Number | I010908 |
| CAS Number | 162831-31-4 |
| Synonyms | N-(Tricyclo[3.3.1.13,7]dec-1-ylmethyl)-1,5-pentanediamine dihydrobromide |
| Molecular Formula | C16H32Br2N2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in water and to 50 mM in DMSO |
| Storage | Store at RT |
| IUPAC Name | N/'-(1-adamantylmethyl)pentane-1,5-diamine;dihydrobromide |
| InChI | InChI=1S/C16H30N2.2BrH/c17-4-2-1-3-5-18-12-16-9-13-6-14(10-16)8-15(7-13)11-16;;/h13-15,18H,1-12,17H2;2*1H |
| InChIKey | JMPHTNNJCZDROM-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)CNCCCCCN.Br.Br |
