For research use only. Not for therapeutic Use.
Janus kinase inhibitor
| Catalog Number | I029205 |
| CAS Number | 1236667-40-5 |
| Synonyms | Ifidancitinib; ifidancitinibum |
| Molecular Formula | C32H33N5O10 |
| Purity | 98% |
| Target | Stem Cell/Wnt |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 5-{[2-(4-fluoro-3-methoxy-5-methylanilino)-5- methylpyrimidin-4-yl]amino}-1,3-benzoxazol-2(3H)-one |
| InChI | InChI=1S/C32H33N5O10/c1-2-13-37(25-10-5-18-14-24-21(15-20(18)25)30(43)36-26(16-38)33-24)19-6-3-17(4-7-19)29(42)35-23(32(46)47)8-11-27(39)34-22(31(44)45)9-12-28(40)41/h1,3-4,6-7,14-15,22-23,25,38H,5,8-13,16H2,(H,34,39)(H,35,42)(H,40,41)(H,44,45)(H,46,47)(H,33,36,43)/t22?,23?,25-/m0/s1 |
| InChIKey | NVHRBQOZEMFKLD-RVMZIBIISA-N |
| SMILES | [H][C@]1(N(C2=CC=C(C(N[C@H](C(O)=O)CCC(N[C@H](CCC(O)=O)C(O)=O)=O)=O)C=C2)CC#C)CCC(C1=C3)=CC4=C3C(N=C(CO)N4)=O |
