For research use only. Not for therapeutic Use.
Igepal CO-520 is a nonionic surfactant widely used in biochemical and industrial applications. It functions as an emulsifier, detergent, and dispersant, aiding in the stabilization of emulsions and enhancing solubility of hydrophobic compounds. This compound is essential for various laboratory and manufacturing processes, ensuring precise and reliable results in research and production.
| Catalog Number | R016538 |
| CAS Number | 68412-54-4 |
| Synonyms | α-(Nonylphenyl)-ω-hydroxy-poly(oxy-1,2-ethanediyl) Branched Polymer, Manual Registration, Generic Registration; |
| Molecular Formula | C19H32O3 |
| Purity | ≥95% |
| Storage | 3 years -20 ℃ powder |
| IUPAC Name | 2-[2-(4-nonylphenoxy)ethoxy]ethanol |
| InChI | InChI=1S/C19H32O3/c1-2-3-4-5-6-7-8-9-18-10-12-19(13-11-18)22-17-16-21-15-14-20/h10-13,20H,2-9,14-17H2,1H3 |
| InChIKey | BLXVTZPGEOGTGG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC1=CC=C(C=C1)OCCOCCO |
