For research use only. Not for therapeutic Use.
IGUANA-1 is a potent inhibitor of ALDH1B1, which is a mitochondrial enzyme that promotes colorectal and pancreatic cancer. IGUANA-1 has significant inhibition against cancer cells[1].
| Catalog Number | I042464 |
| CAS Number | 2756014-25-0 |
| Synonyms | 3-(4-chloro-2-methoxyphenyl)-1-[4-(2-methoxyphenyl)phenyl]-6,7-dihydro-5H-imidazo[1,2-a]pyrimidine;formic acid |
| Molecular Formula | C27H26ClN3O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C26H24ClN3O2.CH2O2/c1-31-24-7-4-3-6-21(24)18-8-11-20(12-9-18)30-17-23(29-15-5-14-28-26(29)30)22-13-10-19(27)16-25(22)32-2;2-1-3/h3-4,6-13,16-17H,5,14-15H2,1-2H3;1H,(H,2,3) |
| InChIKey | GONSQPFNQHUNGK-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=CC=C(C=C2)N3C=C(N4C3=NCCC4)C5=C(C=C(C=C5)Cl)OC.C(=O)O |
| Reference | [1]. Feng Z, et al. Targeting colorectal cancer with small-molecule inhibitors of ALDH1B1. Nat Chem Biol. 2022 Oct;18(10):1065-1075. |
