For research use only. Not for therapeutic Use.
IHMT-MST1-58（Cat No.:I042863）is a small molecule inhibitor designed to target the MST1 protein (Mammalian Ste20-like kinase 1), which is involved in the regulation of immune cell signaling and apoptosis. By inhibiting MST1, IHMT-MST1-58 aims to modulate immune responses and has potential applications in treating autoimmune diseases, inflammatory disorders, and cancer. MST1 plays a critical role in controlling cellular processes like T-cell activation and stress response. Preclinical studies suggest that IHMT-MST1-58 may help in controlling excessive immune activation, with ongoing research focused on optimizing its efficacy and safety for therapeutic use.
| CAS Number | 2414484-25-4 |
| Synonyms | 4-[[5,8-dimethyl-7-(2-methylphenyl)-6-oxo-7H-pteridin-2-yl]amino]benzenesulfonamide |
| Molecular Formula | C21H22N6O3S |
| Purity | ≥95% |
| IUPAC Name | 4-[[5,8-dimethyl-7-(2-methylphenyl)-6-oxo-7H-pteridin-2-yl]amino]benzenesulfonamide |
| InChI | InChI=1S/C21H22N6O3S/c1-13-6-4-5-7-16(13)18-20(28)26(2)17-12-23-21(25-19(17)27(18)3)24-14-8-10-15(11-9-14)31(22,29)30/h4-12,18H,1-3H3,(H2,22,29,30)(H,23,24,25) |
| InChIKey | FWEIAKDAIDQPRK-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2C(=O)N(C3=CN=C(N=C3N2C)NC4=CC=C(C=C4)S(=O)(=O)N)C |
