For research use only. Not for therapeutic Use.
IITZ-01(CAT: I019713) is a potent and selective inhibitor of protein tyrosine phosphatases (PTPs), extensively used in research focused on cell signaling and regulation. By targeting specific PTPs, IITZ-01 plays a critical role in modulating pathways involved in cancer, diabetes, and immune disorders. Its high specificity makes it a valuable tool for exploring therapeutic strategies aimed at correcting aberrant phosphatase activity. Additionally, IITZ-01 is employed in studies investigating the crosstalk between phosphorylation and dephosphorylation events, offering insights into the molecular mechanisms of disease and potential drug development avenues.
CAS Number | 1807988-47-1 |
Molecular Formula | C₂₆H₂₃FN₈O |
Purity | ≥95% |
Target | PI3K/Akt/mTOR |
IUPAC Name | 4-N-[4-(1H-benzimidazol-2-yl)phenyl]-2-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
InChI | InChI=1S/C26H23FN8O/c27-18-7-11-20(12-8-18)29-25-32-24(33-26(34-25)35-13-15-36-16-14-35)28-19-9-5-17(6-10-19)23-30-21-3-1-2-4-22(21)31-23/h1-12H,13-16H2,(H,30,31)(H2,28,29,32,33,34) |
InChIKey | XGEDDGLPNSLBFE-UHFFFAOYSA-N |
SMILES | C1COCCN1C2=NC(=NC(=N2)NC3=CC=C(C=C3)F)NC4=CC=C(C=C4)C5=NC6=CC=CC=C6N5 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |