For research use only. Not for therapeutic Use.
IK-930 (CAT: I040928) is a potent and orally active inhibitor of TEAD (TEA domain transcription factors), with an EC50 value of less than 0.1 µM. TEAD transcription factors play a crucial role in the Hippo signaling pathway, which is involved in regulating cell growth, proliferation, and survival. Dysregulation of TEAD can contribute to various cancers and developmental disorders. IK-930 effectively inhibits TEAD-mediated transcription, offering potential therapeutic benefits for cancer treatment. It demonstrates good pharmacokinetic properties in BALB/c mice, with a Cmax of 1088 ng/mL and AUC 0-last of 4581 ng*h/mL, making it a promising candidate for further Cancer Disease Research.
CAS Number | 2563892-44-2 |
Synonyms | N-methyl-3-(1-methylimidazol-4-yl)-4-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide |
Molecular Formula | C19H19F3N4O2S |
Purity | ≥95% |
IUPAC Name | N-methyl-3-(1-methylimidazol-4-yl)-4-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide |
InChI | InChI=1S/C19H19F3N4O2S/c1-23-29(27,28)15-7-8-17(16(9-15)18-11-26(2)12-25-18)24-10-13-3-5-14(6-4-13)19(20,21)22/h3-9,11-12,23-24H,10H2,1-2H3 |
InChIKey | TVBGCXJDLVRDSU-UHFFFAOYSA-N |
SMILES | CNS(=O)(=O)C1=CC(=C(C=C1)NCC2=CC=C(C=C2)C(F)(F)F)C3=CN(C=N3)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |