For research use only. Not for therapeutic Use.
IKK-16（Cat No.:I005258）, also known as IKK Inhibitor VII, is a selective inhibitor of IκB kinase (IKK) that targets IKK-2, IKK complex, and IKK-1 with IC50 values of 40 nM, 70 nM, and 200 nM, respectively, in cell-free assays. Additionally, IKK-16 can inhibit the phosphorylation of LRRK2 Ser935 in cells and the kinase activity of LRRK2 in vitro, demonstrating its potential as a dual inhibitor of IKK and LRRK2.
| Catalog Number | I005258 |
| CAS Number | 873225-46-8 |
| Synonyms | [4-[[4-(1-benzothiophen-2-yl)pyrimidin-2-yl]amino]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| Molecular Formula | C28H29N5OS |
| Purity | ≥95% |
| Target | IκB/IKK |
| Solubility | DMSO 97 mg/mL ;Water <1mg/mL; Ethanol <1mg/mL |
| Storage | Store at -20°C |
| IC50 | 40 nM(IKK-2); 70 nM(Ikk complex); 200 nM(Ikk-1) |
| IUPAC Name | [4-[[4-(1-benzothiophen-2-yl)pyrimidin-2-yl]amino]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| InChI | InChI=1S/C28H29N5OS/c34-27(33-17-12-23(13-18-33)32-15-3-4-16-32)20-7-9-22(10-8-20)30-28-29-14-11-24(31-28)26-19-21-5-1-2-6-25(21)35-26/h1-2,5-11,14,19,23H,3-4,12-13,15-18H2,(H,29,30,31) |
| InChIKey | BWZJBXAPRCVCKQ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2CCN(CC2)C(=O)C3=CC=C(C=C3)NC4=NC=CC(=N4)C5=CC6=CC=CC=C6S5 |
| Reference | <p style=/line-height:25px/> </p> |
