For research use only. Not for therapeutic Use.
IKK16 (Cat.No:R030655) is a chemical compound that acts as an inhibitor of the IκB kinase (IKK) complex. This complex plays a key role in the activation of the nuclear factor kappa B (NF-κB) pathway, which is involved in inflammation and immune responses. IKK16’s inhibition offers potential for anti-inflammatory and immunomodulatory interventions.
CAS Number | 1186195-62-9 |
Synonyms | [4-[(4-Benzo[b]thien-2-yl-2-pyrimidinyl)amino]phenyl][4-(1-pyrrolidinyl)-1-piperidinyl]-methanone Hydrochloride; |
Molecular Formula | C28H30ClN5OS |
Purity | ≥95% |
Target | Autophagy |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | [4-[[4-(1-benzothiophen-2-yl)pyrimidin-2-yl]amino]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone;hydrochloride |
InChI | InChI=1S/C28H29N5OS.ClH/c34-27(33-17-12-23(13-18-33)32-15-3-4-16-32)20-7-9-22(10-8-20)30-28-29-14-11-24(31-28)26-19-21-5-1-2-6-25(21)35-26;/h1-2,5-11,14,19,23H,3-4,12-13,15-18H2,(H,29,30,31);1H |
InChIKey | XFVDIVQCZWDBCW-UHFFFAOYSA-N |
SMILES | C1CCN(C1)C2CCN(CC2)C(=O)C3=CC=C(C=C3)NC4=NC=CC(=N4)C5=CC6=CC=CC=C6S5.Cl |