For research use only. Not for therapeutic Use.
IL-2-IN-1（Cat No.:I043348）is an investigational compound designed to inhibit interleukin-2 (IL-2) signaling, which plays a key role in immune responses, particularly in the activation and proliferation of T cells. By targeting IL-2 and its receptor, IL-2-IN-1 aims to modulate the immune system in a controlled manner. This inhibition may have therapeutic potential in autoimmune diseases, cancer immunotherapy, and transplant rejection, where IL-2-driven immune activation can be detrimental. Ongoing research is exploring IL-2-IN-1’s efficacy in reducing unwanted immune responses and enhancing the effectiveness of other immune-modulating therapies.
| CAS Number | 245747-10-8 |
| Synonyms | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| Molecular Formula | C17H12F6N4O2 |
| Purity | ≥95% |
| IUPAC Name | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| InChI | InChI=1S/C17H12F6N4O2/c1-8-14(9(2)29-26-8)15(28)24-10-3-5-11(6-4-10)27-13(17(21,22)23)7-12(25-27)16(18,19)20/h3-7H,1-2H3,(H,24,28) |
| InChIKey | LAHVQXKWWOOVLX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C(=O)NC2=CC=C(C=C2)N3C(=CC(=N3)C(F)(F)F)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
