For research use only. Not for therapeutic Use.
Ilimaquinone(Cat No.:R064979)is a marine-derived sesquiterpenoid isolated from sponges, known for its diverse biological activities. It exhibits potent antiviral, antibacterial, and anticancer properties, making it a valuable compound in drug discovery. Ilimaquinone is particularly noted for its ability to inhibit protein secretion by disrupting the Golgi apparatus, providing insights into intracellular trafficking mechanisms. Its anti-inflammatory and cytotoxic effects further enhance its potential in therapeutic research. As a natural product with a unique mode of action, Ilimaquinone continues to inspire investigations into novel treatments for infectious diseases and cancer.
CAS Number | 71678-03-0 |
Synonyms | 3-[[(1R,2S,4aS,8aS)-decahydro-1,2,4a-trimethyl-5-methylene-1-naphthalenyl]methyl]-2-hydroxy-5-methoxy-2,5-cyclohexadiene-1,4-dione |
Molecular Formula | C22H30O4 |
Purity | ≥95% |
Target | HIV |
Storage | -20°C |
IUPAC Name | 3-[[(1R,2S,4aS,8aS)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl]-2-hydroxy-5-methoxycyclohexa-2,5-diene-1,4-dione |
InChI | InChI=1S/C22H30O4/c1-13-7-6-8-18-21(13,3)10-9-14(2)22(18,4)12-15-19(24)16(23)11-17(26-5)20(15)25/h11,14,18,24H,1,6-10,12H2,2-5H3/t14-,18+,21+,22+/m0/s1 |
InChIKey | JJWITJNSXCXULM-YVUMSICPSA-N |
SMILES | C[C@H]1CC[C@]2([C@H]([C@]1(C)CC3=C(C(=O)C=C(C3=O)OC)O)CCCC2=C)C |
Reference | 1.Radeke, H.S.,Digits, C.A.,Casaubon, R.L., et al. Interactions of (−)-ilimaquinone with methylation enzymes: Implications for vesicular-mediated secretion. Chemistry & Biology 6(9), 639-647 (1999). |