For research use only. Not for therapeutic Use.
ILK-IN-1(Cat No.:I001269)is a small molecule inhibitor targeting integrin-linked kinase (ILK), a key protein involved in cell signaling, adhesion, and survival. ILK plays a crucial role in regulating the actin cytoskeleton, cell-matrix interactions, and signaling pathways that are implicated in cancer metastasis, angiogenesis, and fibrosis. By inhibiting ILK activity, ILK-IN-1 has shown potential in preclinical studies for suppressing tumor growth and metastasis, as well as mitigating fibrosis in various tissues. Ongoing research aims to further evaluate ILK-IN-1’s therapeutic potential, safety, and efficacy, particularly in cancer and fibrotic diseases.
CAS Number | 1333146-24-9 |
Molecular Formula | C30H30F3N5O |
Purity | ≥95% |
Target | Integrin |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IC50 | 0.6 μM |
IUPAC Name | N-methyl-3-[1-(4-piperazin-1-ylphenyl)-5-[4-[4-(trifluoromethyl)phenyl]phenyl]pyrazol-3-yl]propanamide |
InChI | InChI=1S/C30H30F3N5O/c1-34-29(39)15-10-25-20-28(38(36-25)27-13-11-26(12-14-27)37-18-16-35-17-19-37)23-4-2-21(3-5-23)22-6-8-24(9-7-22)30(31,32)33/h2-9,11-14,20,35H,10,15-19H2,1H3,(H,34,39) |
InChIKey | GHBUPSVATJKTRR-UHFFFAOYSA-N |
SMILES | CNC(=O)CCC1=NN(C(=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C(F)(F)F)C4=CC=C(C=C4)N5CCNCC5 |
Reference | <p style=/line-height:25px/> </p> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |