For research use only, not for therapeutic use.
Ilk-IN-2(Cat No.:L005361) is a specialized chemical compound with significant implications in the realm of drug discovery and therapeutic development. It operates as an inhibitor targeting a specific kinase enzyme. By modulating the kinase activity, it interferes with key cellular pathways, influencing cell signaling and potentially impacting disease-related processes. This compound’s pharmacological action showcases its potential as a tool compound in research to elucidate intricate cellular mechanisms and as a candidate for the development of novel therapies, particularly in the context of kinase-associated disorders.
| Catalog Number | L005361 |
| CAS Number | 2070015-22-2 |
| Molecular Formula | C30H30F3N5O |
| Purity | ≥95% |
| IUPAC Name | N-methyl-3-[2-(4-piperazin-1-ylphenyl)-5-[4-[4-(trifluoromethyl)phenyl]phenyl]pyrazol-3-yl]propanamide |
| InChI | InChI=1S/C30H30F3N5O/c1-34-29(39)15-14-27-20-28(36-38(27)26-12-10-25(11-13-26)37-18-16-35-17-19-37)23-4-2-21(3-5-23)22-6-8-24(9-7-22)30(31,32)33/h2-13,20,35H,14-19H2,1H3,(H,34,39) |
| InChIKey | AJLOJUFSIDSBNN-UHFFFAOYSA-N |
| SMILES | CNC(=O)CCC1=CC(=NN1C2=CC=C(C=C2)N3CCNCC3)C4=CC=C(C=C4)C5=CC=C(C=C5)C(F)(F)F |
