For research use only. Not for therapeutic Use.
Illudin C(Cat No.:M106599) is a natural compound extracted from the mushroom species Omphalotus illudens. It belongs to the class of sesquiterpenes, compounds known for their complex molecular structures and diverse biological activities. Illudin C has garnered interest for its potent cytotoxic properties, which have potential implications for cancer research. Studies have shown that including C can damage DNA, leading to the death of cancer cells. Its mechanism involves the activation of cellular responses to DNA damage, making it a candidate for drug development, particularly as a chemotherapeutic agent.
CAS Number | 137637-31-1 |
Synonyms | illudin C |
Molecular Formula | C15H20O2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (7S)-7-hydroxy-2,2,7-trimethyl-5-methylidenespiro[1,3-dihydroindene-6,1'-cyclopropane]-4-one |
InChI | InChI=1S/C15H20O2/c1-9-12(16)10-7-13(2,3)8-11(10)14(4,17)15(9)5-6-15/h17H,1,5-8H2,2-4H3/t14-/m0/s1 |
InChIKey | VHHHVRVVSIKHKN-AWEZNQCLSA-N |
SMILES | CC1(CC2=C(C1)C(C3(CC3)C(=C)C2=O)(C)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |